C17H24N2 — CID 565867
N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-5,6,7,8-tetrahydronaphthalen-1-amine (PubChem CID 565867) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-5,6,7,8-tetrahydronaphthalen-1-amine.
| Compound Name | N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-5,6,7,8-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 565867 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-5,6,7,8-tetrahydronaphthalen-1-amine |
| SMILES | CN1CC=C(CNc2cccc3c2CCCC3)CC1 |
| InChI | InChI=1S/C17H24N2/c1-19-11-9-14(10-12-19)13-18-17-8-4-6-15-5-2-3-7-16(15)17/h4,6,8-9,18H,2-3,5,7,10-13H2,1H3 |
| InChIKey | FECKTPOVZVMFFA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|