C17H17F4N3O2S — CID 56587215
1-[(3-fluorophenyl)methylsulfonyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 56587215) has the molecular formula C17H17F4N3O2S and a molecular weight of 403.40 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methylsulfonyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-[(3-fluorophenyl)methylsulfonyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 56587215 |
| Molecular Formula | C17H17F4N3O2S |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 1-[(3-fluorophenyl)methylsulfonyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | O=S(=O)(Cc1cccc(F)c1)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C17H17F4N3O2S/c18-15-3-1-2-13(10-15)12-27(25,26)24-8-6-23(7-9-24)16-5-4-14(11-22-16)17(19,20)21/h1-5,10-11H,6-9,12H2 |
| InChIKey | YOUSHSKNXMRWSU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |