C22H22N2O6S — CID 56587383
N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 56587383) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 56587383 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[[1-(2,3-dihydro-1,4-benzodioxin-6-yl)cyclopentyl]methyl]-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | O=C1NC(=O)c2cc(S(=O)(=O)NCC3(c4ccc5c(c4)OCCO5)CCCC3)ccc21 |
| InChI | InChI=1S/C22H22N2O6S/c25-20-16-5-4-15(12-17(16)21(26)24-20)31(27,28)23-13-22(7-1-2-8-22)14-3-6-18-19(11-14)30-10-9-29-18/h3-6,11-12,23H,1-2,7-10,13H2,(H,24,25,26) |
| InChIKey | XBKDLCVTNIUHQM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|