About [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate
[4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate (PubChem CID 56587615) has the molecular formula C18H12N2O5S2
and a molecular weight of 400.44 g/mol. Its IUPAC name is [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate.
Molecular Properties
| Compound Name | [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate |
| PubChem CID | 56587615 |
| Molecular Formula | C18H12N2O5S2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate |
| SMILES | Cc1csc(-c2ccc(OS(=O)(=O)c3ccc4c(c3)C(=O)NC4=O)cc2)n1 |
| InChI | InChI=1S/C18H12N2O5S2/c1-10-9-26-18(19-10)11-2-4-12(5-3-11)25-27(23,24)13-6-7-14-15(8-13)17(22)20-16(14)21/h2-9H,1H3,(H,20,21,22) |
| InChIKey | QJNGEPVFMDBMIF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate?
The IUPAC name of [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate (CID 56587615) is [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate.
What is the SMILES notation for [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate?
The canonical SMILES for [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate is Cc1csc(-c2ccc(OS(=O)(=O)c3ccc4c(c3)C(=O)NC4=O)cc2)n1.
What is the InChIKey of [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate?
The InChIKey is QJNGEPVFMDBMIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O5S2/c1-10-9-26-18(19-10)11-2-4-12(5-3-11)25-27(23,24)13-6-7-14-15(8-13)17(22)20-16(14)21/h2-9H,1H3,(H,20,21,22).
What are the key properties of [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate?
[4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate has a molecular weight of 400.44 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methyl-1,3-thiazol-2-yl)phenyl] 1,3-dioxoisoindole-5-sulfonate is sourced from PubChem (CID 56587615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).