About N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride
N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride (PubChem CID 56587816) has the molecular formula C12H9Cl2N3O
and a molecular weight of 282.13 g/mol. Its IUPAC name is N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride |
| PubChem CID | 56587816 |
| Molecular Formula | C12H9Cl2N3O |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride |
| SMILES | Cl.Clc1cccc(Nc2noc3cccnc23)c1 |
| InChI | InChI=1S/C12H8ClN3O.ClH/c13-8-3-1-4-9(7-8)15-12-11-10(17-16-12)5-2-6-14-11;/h1-7H,(H,15,16);1H |
| InChIKey | CISLMCAUOWQLOE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride?
The IUPAC name of N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride (CID 56587816) is N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride.
What is the SMILES notation for N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride?
The canonical SMILES for N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride is Cl.Clc1cccc(Nc2noc3cccnc23)c1.
What is the InChIKey of N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride?
The InChIKey is CISLMCAUOWQLOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClN3O.ClH/c13-8-3-1-4-9(7-8)15-12-11-10(17-16-12)5-2-6-14-11;/h1-7H,(H,15,16);1H.
What are the key properties of N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride?
N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride has a molecular weight of 282.13 g/mol, XLogP of 4.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-[1,2]oxazolo[4,5-b]pyridin-3-amine;hydrochloride is sourced from PubChem (CID 56587816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).