C18H13F3N4O2 — CID 56587963
4-[[4-[2-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzoic acid (PubChem CID 56587963) has the molecular formula C18H13F3N4O2 and a molecular weight of 374.32 g/mol. Its IUPAC name is 4-[[4-[2-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzoic acid.
| Compound Name | 4-[[4-[2-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 56587963 |
| Molecular Formula | C18H13F3N4O2 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-[[4-[2-(trifluoromethyl)anilino]pyrimidin-2-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nccc(Nc3ccccc3C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C18H13F3N4O2/c19-18(20,21)13-3-1-2-4-14(13)24-15-9-10-22-17(25-15)23-12-7-5-11(6-8-12)16(26)27/h1-10H,(H,26,27)(H2,22,23,24,25) |
| InChIKey | QFNWNXOHCUAEBM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |