About 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine
6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine (PubChem CID 56588634) has the molecular formula C18H15FN2O2S2
and a molecular weight of 374.46 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine.
Molecular Properties
| Compound Name | 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine |
| PubChem CID | 56588634 |
| Molecular Formula | C18H15FN2O2S2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine |
| SMILES | O=S(=O)(c1cccs1)N1CCCc2nc(-c3ccc(F)cc3)ccc21 |
| InChI | InChI=1S/C18H15FN2O2S2/c19-14-7-5-13(6-8-14)15-9-10-17-16(20-15)3-1-11-21(17)25(22,23)18-4-2-12-24-18/h2,4-10,12H,1,3,11H2 |
| InChIKey | PXDFDQIBGWKUAX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine?
The IUPAC name of 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine (CID 56588634) is 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine.
What is the SMILES notation for 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine?
The canonical SMILES for 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine is O=S(=O)(c1cccs1)N1CCCc2nc(-c3ccc(F)cc3)ccc21.
What is the InChIKey of 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine?
The InChIKey is PXDFDQIBGWKUAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2O2S2/c19-14-7-5-13(6-8-14)15-9-10-17-16(20-15)3-1-11-21(17)25(22,23)18-4-2-12-24-18/h2,4-10,12H,1,3,11H2.
What are the key properties of 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine?
6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine has a molecular weight of 374.46 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)-1-thiophen-2-ylsulfonyl-3,4-dihydro-2H-1,5-naphthyridine is sourced from PubChem (CID 56588634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).