About 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one
5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one (PubChem CID 56588827) has the molecular formula C20H18FN3O2
and a molecular weight of 351.38 g/mol. Its IUPAC name is 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one.
Molecular Properties
| Compound Name | 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one |
| PubChem CID | 56588827 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one |
| SMILES | COCc1[nH]nc2c1C(c1ccc(F)cc1)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C20H18FN3O2/c1-26-12-16-17-18(23-22-16)20(25)24(11-13-5-3-2-4-6-13)19(17)14-7-9-15(21)10-8-14/h2-10,19H,11-12H2,1H3,(H,22,23) |
| InChIKey | IPNWMUABFITINB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one?
The IUPAC name of 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one (CID 56588827) is 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one.
What is the SMILES notation for 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one?
The canonical SMILES for 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one is COCc1[nH]nc2c1C(c1ccc(F)cc1)N(Cc1ccccc1)C2=O.
What is the InChIKey of 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one?
The InChIKey is IPNWMUABFITINB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FN3O2/c1-26-12-16-17-18(23-22-16)20(25)24(11-13-5-3-2-4-6-13)19(17)14-7-9-15(21)10-8-14/h2-10,19H,11-12H2,1H3,(H,22,23).
What are the key properties of 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one?
5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one has a molecular weight of 351.38 g/mol, XLogP of 3.44, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-4-(4-fluorophenyl)-3-(methoxymethyl)-2,4-dihydropyrrolo[3,4-c]pyrazol-6-one is sourced from PubChem (CID 56588827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).