C17H16BrN3O4 — CID 56588954
methyl (1R,10S,13R)-13-(2-bromophenyl)-2,9-dioxa-4,7,12-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-12-carboxylate (PubChem CID 56588954) has the molecular formula C17H16BrN3O4 and a molecular weight of 406.24 g/mol. Its IUPAC name is methyl (1R,10S,13R)-13-(2-bromophenyl)-2,9-dioxa-4,7,12-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-12-carboxylate.
| Compound Name | methyl (1R,10S,13R)-13-(2-bromophenyl)-2,9-dioxa-4,7,12-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-12-carboxylate |
|---|---|
| PubChem CID | 56588954 |
| Molecular Formula | C17H16BrN3O4 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | methyl (1R,10S,13R)-13-(2-bromophenyl)-2,9-dioxa-4,7,12-triazatricyclo[8.4.0.03,8]tetradeca-3,5,7-triene-12-carboxylate |
| SMILES | COC(=O)N1C[C@@H]2Oc3nccnc3O[C@@H]2C[C@@H]1c1ccccc1Br |
| InChI | InChI=1S/C17H16BrN3O4/c1-23-17(22)21-9-14-13(24-15-16(25-14)20-7-6-19-15)8-12(21)10-4-2-3-5-11(10)18/h2-7,12-14H,8-9H2,1H3/t12-,13-,14+/m1/s1 |
| InChIKey | PXFMHKWECQMCEC-MCIONIFRSA-N |
| XLogP | 2.96 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |