C24H25NO4 — CID 56589007
diethyl 1,11-dimethyl-8-phenyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate (PubChem CID 56589007) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is diethyl 1,11-dimethyl-8-phenyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate.
| Compound Name | diethyl 1,11-dimethyl-8-phenyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 56589007 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | diethyl 1,11-dimethyl-8-phenyl-11-azatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene-9,10-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2(c3ccccc3)c3ccccc3C1(C)N2C |
| InChI | InChI=1S/C24H25NO4/c1-5-28-21(26)19-20(22(27)29-6-2)24(16-12-8-7-9-13-16)18-15-11-10-14-17(18)23(19,3)25(24)4/h7-15H,5-6H2,1-4H3 |
| InChIKey | PAUMODLKALGKHY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |