C33H33N3O3 — CID 56589053
(E)-N-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-11-phenyl-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-N-methyl-3-phenylprop-2-enamide (PubChem CID 56589053) has the molecular formula C33H33N3O3 and a molecular weight of 519.65 g/mol. Its IUPAC name is (E)-N-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-11-phenyl-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-N-methyl-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-11-phenyl-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-N-methyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 56589053 |
| Molecular Formula | C33H33N3O3 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | (E)-N-[(2S,3R,12bS)-3-[(1S)-1-hydroxyethyl]-4-oxo-11-phenyl-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-N-methyl-3-phenylprop-2-enamide |
| SMILES | C[C@H](O)[C@@H]1C(=O)N2CCc3c([nH]c4c(-c5ccccc5)cccc34)[C@@H]2C[C@@H]1N(C)C(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C33H33N3O3/c1-21(37)30-27(35(2)29(38)17-16-22-10-5-3-6-11-22)20-28-32-26(18-19-36(28)33(30)39)25-15-9-14-24(31(25)34-32)23-12-7-4-8-13-23/h3-17,21,27-28,30,34,37H,18-20H2,1-2H3/b17-16+/t21-,27-,28-,30-/m0/s1 |
| InChIKey | MECUSQAIGSXPQC-BJYQBBBCSA-N |
| XLogP | 5.20 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|