C20H30O2 — CID 56589136
(1S,4aR,8aS)-1-hydroxy-1-methyl-6-(4-methylpent-3-enyl)-4-propan-2-yl-4a,5,8,8a-tetrahydronaphthalen-2-one (PubChem CID 56589136) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,4aR,8aS)-1-hydroxy-1-methyl-6-(4-methylpent-3-enyl)-4-propan-2-yl-4a,5,8,8a-tetrahydronaphthalen-2-one.
| Compound Name | (1S,4aR,8aS)-1-hydroxy-1-methyl-6-(4-methylpent-3-enyl)-4-propan-2-yl-4a,5,8,8a-tetrahydronaphthalen-2-one |
|---|---|
| PubChem CID | 56589136 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,4aR,8aS)-1-hydroxy-1-methyl-6-(4-methylpent-3-enyl)-4-propan-2-yl-4a,5,8,8a-tetrahydronaphthalen-2-one |
| SMILES | CC(C)=CCCC1=CC[C@H]2[C@@H](C1)C(C(C)C)=CC(=O)[C@@]2(C)O |
| InChI | InChI=1S/C20H30O2/c1-13(2)7-6-8-15-9-10-18-17(11-15)16(14(3)4)12-19(21)20(18,5)22/h7,9,12,14,17-18,22H,6,8,10-11H2,1-5H3/t17-,18-,20-/m0/s1 |
| InChIKey | IHFQHBMMXQUBQH-BJLQDIEVSA-N |
| XLogP | 4.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|