About (1-methylcyclohexyl) propanoate
(1-methylcyclohexyl) propanoate (PubChem CID 565892) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (1-methylcyclohexyl) propanoate.
Molecular Properties
| Compound Name | (1-methylcyclohexyl) propanoate |
| PubChem CID | 565892 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (1-methylcyclohexyl) propanoate |
| SMILES | CCC(=O)OC1(C)CCCCC1 |
| InChI | InChI=1S/C10H18O2/c1-3-9(11)12-10(2)7-5-4-6-8-10/h3-8H2,1-2H3 |
| InChIKey | JOVZWOOOHJRNCD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-methylcyclohexyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclohexyl) propanoate?
The IUPAC name of (1-methylcyclohexyl) propanoate (CID 565892) is (1-methylcyclohexyl) propanoate.
What is the SMILES notation for (1-methylcyclohexyl) propanoate?
The canonical SMILES for (1-methylcyclohexyl) propanoate is CCC(=O)OC1(C)CCCCC1.
What is the InChIKey of (1-methylcyclohexyl) propanoate?
The InChIKey is JOVZWOOOHJRNCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-9(11)12-10(2)7-5-4-6-8-10/h3-8H2,1-2H3.
What are the key properties of (1-methylcyclohexyl) propanoate?
(1-methylcyclohexyl) propanoate has a molecular weight of 170.25 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclohexyl) propanoate is sourced from PubChem (CID 565892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).