About 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid
2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid (PubChem CID 56589527) has the molecular formula C10H10FN2O5P
and a molecular weight of 288.17 g/mol. Its IUPAC name is 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid.
Molecular Properties
| Compound Name | 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid |
| PubChem CID | 56589527 |
| Molecular Formula | C10H10FN2O5P |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid |
| SMILES | O=C(O)C(F)(Cc1cnc2ccccn12)P(=O)(O)O |
| InChI | InChI=1S/C10H10FN2O5P/c11-10(9(14)15,19(16,17)18)5-7-6-12-8-3-1-2-4-13(7)8/h1-4,6H,5H2,(H,14,15)(H2,16,17,18) |
| InChIKey | QNTZKVWJSZGWHM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid?
The IUPAC name of 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid (CID 56589527) is 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid.
What is the SMILES notation for 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid?
The canonical SMILES for 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid is O=C(O)C(F)(Cc1cnc2ccccn12)P(=O)(O)O.
What is the InChIKey of 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid?
The InChIKey is QNTZKVWJSZGWHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN2O5P/c11-10(9(14)15,19(16,17)18)5-7-6-12-8-3-1-2-4-13(7)8/h1-4,6H,5H2,(H,14,15)(H2,16,17,18).
What are the key properties of 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid?
2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid has a molecular weight of 288.17 g/mol, XLogP of 0.80, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-imidazo[1,2-a]pyridin-3-yl-2-phosphonopropanoic acid is sourced from PubChem (CID 56589527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).