C28H27F4N3O — CID 56589546
N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-[7-[[3-(trifluoromethyl)phenyl]methyl]quinolin-4-yl]propane-1,3-diamine (PubChem CID 56589546) has the molecular formula C28H27F4N3O and a molecular weight of 497.54 g/mol. Its IUPAC name is N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-[7-[[3-(trifluoromethyl)phenyl]methyl]quinolin-4-yl]propane-1,3-diamine.
| Compound Name | N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-[7-[[3-(trifluoromethyl)phenyl]methyl]quinolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 56589546 |
| Molecular Formula | C28H27F4N3O |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | N-[(5-fluoro-2-methoxyphenyl)methyl]-N'-[7-[[3-(trifluoromethyl)phenyl]methyl]quinolin-4-yl]propane-1,3-diamine |
| SMILES | COc1ccc(F)cc1CNCCCNc1ccnc2cc(Cc3cccc(C(F)(F)F)c3)ccc12 |
| InChI | InChI=1S/C28H27F4N3O/c1-36-27-9-7-23(29)17-21(27)18-33-11-3-12-34-25-10-13-35-26-16-20(6-8-24(25)26)14-19-4-2-5-22(15-19)28(30,31)32/h2,4-10,13,15-17,33H,3,11-12,14,18H2,1H3,(H,34,35) |
| InChIKey | YYAAUSAAJVJTJS-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|