C32H43F4NO3S — CID 56589644
6-(4-fluorophenyl)-5-[6-[methyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 56589644) has the molecular formula C32H43F4NO3S and a molecular weight of 597.76 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-5-[6-[methyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(4-fluorophenyl)-5-[6-[methyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 56589644 |
| Molecular Formula | C32H43F4NO3S |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | 6-(4-fluorophenyl)-5-[6-[methyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | CN(CCCCCCC1=C(c2ccc(F)cc2)CCCc2cc(O)ccc21)CCCCS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C32H43F4NO3S/c1-37(21-6-7-22-41(39,40)23-9-19-32(34,35)36)20-5-3-2-4-11-31-29(25-13-15-27(33)16-14-25)12-8-10-26-24-28(38)17-18-30(26)31/h13-18,24,38H,2-12,19-23H2,1H3 |
| InChIKey | MYPURAMMRGKUPN-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|