About 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid
3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid (PubChem CID 56589667) has the molecular formula C18H19N3O3
and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid.
Molecular Properties
| Compound Name | 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid |
| PubChem CID | 56589667 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid |
| SMILES | CN(C)CCNC(=O)c1ccc2c(C(=O)O)c3ccccn3c2c1 |
| InChI | InChI=1S/C18H19N3O3/c1-20(2)10-8-19-17(22)12-6-7-13-15(11-12)21-9-4-3-5-14(21)16(13)18(23)24/h3-7,9,11H,8,10H2,1-2H3,(H,19,22)(H,23,24) |
| InChIKey | OMVKEKNQENTGRO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid?
The IUPAC name of 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid (CID 56589667) is 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid.
What is the SMILES notation for 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid?
The canonical SMILES for 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid is CN(C)CCNC(=O)c1ccc2c(C(=O)O)c3ccccn3c2c1.
What is the InChIKey of 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid?
The InChIKey is OMVKEKNQENTGRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O3/c1-20(2)10-8-19-17(22)12-6-7-13-15(11-12)21-9-4-3-5-14(21)16(13)18(23)24/h3-7,9,11H,8,10H2,1-2H3,(H,19,22)(H,23,24).
What are the key properties of 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid?
3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid has a molecular weight of 325.37 g/mol, XLogP of 2.08, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylic acid is sourced from PubChem (CID 56589667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).