About 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole
1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole (PubChem CID 56589754) has the molecular formula C30H26N2O
and a molecular weight of 430.55 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole |
| PubChem CID | 56589754 |
| Molecular Formula | C30H26N2O |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole |
| SMILES | COc1ccc(-n2nc(-c3ccc(C)cc3)c(-c3ccccc3)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H26N2O/c1-21-9-13-24(14-10-21)29-28(23-7-5-4-6-8-23)30(25-15-11-22(2)12-16-25)32(31-29)26-17-19-27(33-3)20-18-26/h4-20H,1-3H3 |
| InChIKey | KAGADSOKFAIVIZ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole?
The IUPAC name of 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole (CID 56589754) is 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole.
What is the SMILES notation for 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole?
The canonical SMILES for 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole is COc1ccc(-n2nc(-c3ccc(C)cc3)c(-c3ccccc3)c2-c2ccc(C)cc2)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole?
The InChIKey is KAGADSOKFAIVIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H26N2O/c1-21-9-13-24(14-10-21)29-28(23-7-5-4-6-8-23)30(25-15-11-22(2)12-16-25)32(31-29)26-17-19-27(33-3)20-18-26/h4-20H,1-3H3.
What are the key properties of 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole?
1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole has a molecular weight of 430.55 g/mol, XLogP of 7.50, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-3,5-bis(4-methylphenyl)-4-phenylpyrazole is sourced from PubChem (CID 56589754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).