C16H16ClN — CID 56590209
(4S)-4-benzyl-7-chloro-1,2,3,4-tetrahydroquinoline (PubChem CID 56590209) has the molecular formula C16H16ClN and a molecular weight of 257.76 g/mol. Its IUPAC name is (4S)-4-benzyl-7-chloro-1,2,3,4-tetrahydroquinoline.
| Compound Name | (4S)-4-benzyl-7-chloro-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 56590209 |
| Molecular Formula | C16H16ClN |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | (4S)-4-benzyl-7-chloro-1,2,3,4-tetrahydroquinoline |
| SMILES | Clc1ccc2c(c1)NCC[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C16H16ClN/c17-14-6-7-15-13(8-9-18-16(15)11-14)10-12-4-2-1-3-5-12/h1-7,11,13,18H,8-10H2/t13-/m1/s1 |
| InChIKey | JPDXWDDCOHYIAF-CYBMUJFWSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |