C17H24O4 — CID 56590308
ethyl 2-[(1aR,1bS,5aS,6aS)-1b-methyl-6-methylidene-3-oxo-1a,2,4,5,5a,6a-hexahydro-1H-cyclopropa[a]inden-4-yl]-2-hydroxypropanoate (PubChem CID 56590308) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl 2-[(1aR,1bS,5aS,6aS)-1b-methyl-6-methylidene-3-oxo-1a,2,4,5,5a,6a-hexahydro-1H-cyclopropa[a]inden-4-yl]-2-hydroxypropanoate.
| Compound Name | ethyl 2-[(1aR,1bS,5aS,6aS)-1b-methyl-6-methylidene-3-oxo-1a,2,4,5,5a,6a-hexahydro-1H-cyclopropa[a]inden-4-yl]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 56590308 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | ethyl 2-[(1aR,1bS,5aS,6aS)-1b-methyl-6-methylidene-3-oxo-1a,2,4,5,5a,6a-hexahydro-1H-cyclopropa[a]inden-4-yl]-2-hydroxypropanoate |
| SMILES | C=C1[C@H]2C[C@H]2[C@]2(C)CC(=O)C(C(C)(O)C(=O)OCC)C[C@@H]12 |
| InChI | InChI=1S/C17H24O4/c1-5-21-15(19)17(4,20)13-7-11-9(2)10-6-12(10)16(11,3)8-14(13)18/h10-13,20H,2,5-8H2,1,3-4H3/t10-,11+,12-,13?,16-,17?/m1/s1 |
| InChIKey | NXUCBJXGOIMRFY-PAPBIPEVSA-N |
| XLogP | 2.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|