C17H22BrNO7S — CID 56590484
1-O-tert-butyl 2-O-methyl (2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate (PubChem CID 56590484) has the molecular formula C17H22BrNO7S and a molecular weight of 464.33 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 56590484 |
| Molecular Formula | C17H22BrNO7S |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-(4-bromophenyl)sulfonyloxypyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OS(=O)(=O)c2ccc(Br)cc2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H22BrNO7S/c1-17(2,3)25-16(21)19-10-12(9-14(19)15(20)24-4)26-27(22,23)13-7-5-11(18)6-8-13/h5-8,12,14H,9-10H2,1-4H3/t12-,14-/m0/s1 |
| InChIKey | QDSVLWCXASHQMV-JSGCOSHPSA-N |
| XLogP | 2.71 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|