C16H23NO4 — CID 56590526
(2R,3aR,6R,7R,7aS)-2-methyl-4-(2-phenylethyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,6,7-triol (PubChem CID 56590526) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (2R,3aR,6R,7R,7aS)-2-methyl-4-(2-phenylethyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,6,7-triol.
| Compound Name | (2R,3aR,6R,7R,7aS)-2-methyl-4-(2-phenylethyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,6,7-triol |
|---|---|
| PubChem CID | 56590526 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (2R,3aR,6R,7R,7aS)-2-methyl-4-(2-phenylethyl)-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,6,7-triol |
| SMILES | C[C@]1(O)C[C@@H]2[C@H](O1)[C@H](O)[C@H](O)CN2CCc1ccccc1 |
| InChI | InChI=1S/C16H23NO4/c1-16(20)9-12-15(21-16)14(19)13(18)10-17(12)8-7-11-5-3-2-4-6-11/h2-6,12-15,18-20H,7-10H2,1H3/t12-,13-,14-,15+,16-/m1/s1 |
| InChIKey | ZGAZZHQLINYKOT-DGXTUMSLSA-N |
| XLogP | 0.13 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |