C22H28BNO5 — CID 56590596
1-[(2S,3S)-3-phenyloxiran-2-yl]-5-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione (PubChem CID 56590596) has the molecular formula C22H28BNO5 and a molecular weight of 397.28 g/mol. Its IUPAC name is 1-[(2S,3S)-3-phenyloxiran-2-yl]-5-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione.
| Compound Name | 1-[(2S,3S)-3-phenyloxiran-2-yl]-5-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
|---|---|
| PubChem CID | 56590596 |
| Molecular Formula | C22H28BNO5 |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 1-[(2S,3S)-3-phenyloxiran-2-yl]-5-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,8-dioxa-5-azonia-1-boranuidabicyclo[3.3.0]octane-3,7-dione |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1[N+]13CC(=O)O[B-]1([C@@H]1O[C@H]1c1ccccc1)OC(=O)C3)C2(C)C |
| InChI | InChI=1S/C22H28BNO5/c1-13-16-9-15(22(16,2)3)10-17(13)24-11-18(25)28-23(24,29-19(26)12-24)21-20(27-21)14-7-5-4-6-8-14/h4-8,13,15-17,20-21H,9-12H2,1-3H3/t13-,15+,16-,17-,20+,21-,23?,24?/m1/s1 |
| InChIKey | CXFAUCUIYVIERU-UKJRAGRISA-N |
| XLogP | 2.61 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|