C17H15F3N2 — CID 56590616
3,5-diphenyl-2-(2,2,2-trifluoroethyl)-3,4-dihydropyrazole (PubChem CID 56590616) has the molecular formula C17H15F3N2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 3,5-diphenyl-2-(2,2,2-trifluoroethyl)-3,4-dihydropyrazole.
| Compound Name | 3,5-diphenyl-2-(2,2,2-trifluoroethyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 56590616 |
| Molecular Formula | C17H15F3N2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3,5-diphenyl-2-(2,2,2-trifluoroethyl)-3,4-dihydropyrazole |
| SMILES | FC(F)(F)CN1N=C(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C17H15F3N2/c18-17(19,20)12-22-16(14-9-5-2-6-10-14)11-15(21-22)13-7-3-1-4-8-13/h1-10,16H,11-12H2 |
| InChIKey | KMJUFGHMKFXZOG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |