C17H13F3N2 — CID 56590688
3,5-diphenyl-1-(2,2,2-trifluoroethyl)pyrazole (PubChem CID 56590688) has the molecular formula C17H13F3N2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 3,5-diphenyl-1-(2,2,2-trifluoroethyl)pyrazole.
| Compound Name | 3,5-diphenyl-1-(2,2,2-trifluoroethyl)pyrazole |
|---|---|
| PubChem CID | 56590688 |
| Molecular Formula | C17H13F3N2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3,5-diphenyl-1-(2,2,2-trifluoroethyl)pyrazole |
| SMILES | FC(F)(F)Cn1nc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C17H13F3N2/c18-17(19,20)12-22-16(14-9-5-2-6-10-14)11-15(21-22)13-7-3-1-4-8-13/h1-11H,12H2 |
| InChIKey | NNYSWUGCOYLPIM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |