C39H52O7Si — CID 56590733
[(3E,5S,8E)-4-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-7,7-dimethyl-6,10-dioxodeca-1,3,8-trien-5-yl] acetate (PubChem CID 56590733) has the molecular formula C39H52O7Si and a molecular weight of 660.92 g/mol. Its IUPAC name is [(3E,5S,8E)-4-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-7,7-dimethyl-6,10-dioxodeca-1,3,8-trien-5-yl] acetate.
| Compound Name | [(3E,5S,8E)-4-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-7,7-dimethyl-6,10-dioxodeca-1,3,8-trien-5-yl] acetate |
|---|---|
| PubChem CID | 56590733 |
| Molecular Formula | C39H52O7Si |
| Molecular Weight | 660.92 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | [(3E,5S,8E)-4-[(2S)-2-[tert-butyl(diphenyl)silyl]oxy-3-[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]propyl]-7,7-dimethyl-6,10-dioxodeca-1,3,8-trien-5-yl] acetate |
| SMILES | C=C/C=C(\C[C@@H](C[C@H]1OC(C)(C)O[C@@H]1C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](OC(C)=O)C(=O)C(C)(C)/C=C/C=O |
| InChI | InChI=1S/C39H52O7Si/c1-11-19-30(35(43-29(3)41)36(42)38(7,8)24-18-25-40)26-31(27-34-28(2)44-39(9,10)45-34)46-47(37(4,5)6,32-20-14-12-15-21-32)33-22-16-13-17-23-33/h11-25,28,31,34-35H,1,26-27H2,2-10H3/b24-18+,30-19+/t28-,31+,34-,35+/m1/s1 |
| InChIKey | IBLZQVXRIXPRPO-KMHLBYDISA-N |
| XLogP | 6.65 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.92 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|