C17H24O3 — CID 56590750
[(1R,3S,6R,7R,8R,9R)-6,7,10,10-tetramethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate (PubChem CID 56590750) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is [(1R,3S,6R,7R,8R,9R)-6,7,10,10-tetramethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate.
| Compound Name | [(1R,3S,6R,7R,8R,9R)-6,7,10,10-tetramethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate |
|---|---|
| PubChem CID | 56590750 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [(1R,3S,6R,7R,8R,9R)-6,7,10,10-tetramethyl-5-oxo-9-tetracyclo[6.3.0.02,4.03,7]undecanyl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H]2[C@H](CC1(C)C)C1C3C(=O)[C@H](C)[C@]2(C)[C@H]31 |
| InChI | InChI=1S/C17H24O3/c1-7-14(19)11-10-9-6-16(3,4)15(20-8(2)18)12(9)17(7,5)13(10)11/h7,9-13,15H,6H2,1-5H3/t7-,9+,10?,11?,12-,13-,15+,17-/m0/s1 |
| InChIKey | RAVSBAOSGQATOZ-DPNSSHPDSA-N |
| XLogP | 2.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |