About 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline
3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline (PubChem CID 56590990) has the molecular formula C16H15N5
and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline.
Molecular Properties
| Compound Name | 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline |
| PubChem CID | 56590990 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline |
| SMILES | Cc1ccc2c(c1)CN1N=NN(Cc3ccccc3)C1=N2 |
| InChI | InChI=1S/C16H15N5/c1-12-7-8-15-14(9-12)11-21-16(17-15)20(18-19-21)10-13-5-3-2-4-6-13/h2-9H,10-11H2,1H3 |
| InChIKey | PPMJVJODKXFUEL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline?
The IUPAC name of 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline (CID 56590990) is 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline.
What is the SMILES notation for 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline?
The canonical SMILES for 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline is Cc1ccc2c(c1)CN1N=NN(Cc3ccccc3)C1=N2.
What is the InChIKey of 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline?
The InChIKey is PPMJVJODKXFUEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5/c1-12-7-8-15-14(9-12)11-21-16(17-15)20(18-19-21)10-13-5-3-2-4-6-13/h2-9H,10-11H2,1H3.
What are the key properties of 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline?
3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline has a molecular weight of 277.33 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-7-methyl-9H-tetrazolo[5,1-b]quinazoline is sourced from PubChem (CID 56590990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).