C23H40N2O5 — CID 56591065
ethyl (E,4S)-6-methyl-4-[[(E,4S)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoyl]amino]hept-2-enoate (PubChem CID 56591065) has the molecular formula C23H40N2O5 and a molecular weight of 424.58 g/mol. Its IUPAC name is ethyl (E,4S)-6-methyl-4-[[(E,4S)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoyl]amino]hept-2-enoate.
| Compound Name | ethyl (E,4S)-6-methyl-4-[[(E,4S)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoyl]amino]hept-2-enoate |
|---|---|
| PubChem CID | 56591065 |
| Molecular Formula | C23H40N2O5 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | ethyl (E,4S)-6-methyl-4-[[(E,4S)-6-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]hept-2-enoyl]amino]hept-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CC(C)C)NC(=O)/C=C/[C@H](CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H40N2O5/c1-9-29-21(27)13-11-18(14-16(2)3)24-20(26)12-10-19(15-17(4)5)25-22(28)30-23(6,7)8/h10-13,16-19H,9,14-15H2,1-8H3,(H,24,26)(H,25,28)/b12-10+,13-11+/t18-,19-/m1/s1 |
| InChIKey | VJBOTASPUZOTLR-XEWHYRIZSA-N |
| XLogP | 4.13 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|