C28H30FN7O3 — CID 56591383
N-[(3R,6S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-6-(hydrazinecarbonyl)piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-1H-indazole-5-carboxamide (PubChem CID 56591383) has the molecular formula C28H30FN7O3 and a molecular weight of 531.59 g/mol. Its IUPAC name is N-[(3R,6S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-6-(hydrazinecarbonyl)piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-1H-indazole-5-carboxamide.
| Compound Name | N-[(3R,6S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-6-(hydrazinecarbonyl)piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 56591383 |
| Molecular Formula | C28H30FN7O3 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | N-[(3R,6S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-6-(hydrazinecarbonyl)piperidin-3-yl]-3-(2-methyl-4-pyridinyl)-1H-indazole-5-carboxamide |
| SMILES | COc1cccc(F)c1CN1C[C@H](NC(=O)c2ccc3[nH]nc(-c4ccnc(C)c4)c3c2)CC[C@H]1C(=O)NN |
| InChI | InChI=1S/C28H30FN7O3/c1-16-12-17(10-11-31-16)26-20-13-18(6-8-23(20)34-35-26)27(37)32-19-7-9-24(28(38)33-30)36(14-19)15-21-22(29)4-3-5-25(21)39-2/h3-6,8,10-13,19,24H,7,9,14-15,30H2,1-2H3,(H,32,37)(H,33,38)(H,34,35)/t19-,24+/m1/s1 |
| InChIKey | MEAGXPLLLCHWCX-DVECYGJZSA-N |
| XLogP | 2.83 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|