C29H28N4O3S — CID 56591396
3-(1-benzothiophen-5-yl)-N-[(3R)-1-[(2-hydroxy-6-methoxyphenyl)methyl]piperidin-3-yl]-1H-indazole-5-carboxamide (PubChem CID 56591396) has the molecular formula C29H28N4O3S and a molecular weight of 512.64 g/mol. Its IUPAC name is 3-(1-benzothiophen-5-yl)-N-[(3R)-1-[(2-hydroxy-6-methoxyphenyl)methyl]piperidin-3-yl]-1H-indazole-5-carboxamide.
| Compound Name | 3-(1-benzothiophen-5-yl)-N-[(3R)-1-[(2-hydroxy-6-methoxyphenyl)methyl]piperidin-3-yl]-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 56591396 |
| Molecular Formula | C29H28N4O3S |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 3-(1-benzothiophen-5-yl)-N-[(3R)-1-[(2-hydroxy-6-methoxyphenyl)methyl]piperidin-3-yl]-1H-indazole-5-carboxamide |
| SMILES | COc1cccc(O)c1CN1CCC[C@@H](NC(=O)c2ccc3[nH]nc(-c4ccc5sccc5c4)c3c2)C1 |
| InChI | InChI=1S/C29H28N4O3S/c1-36-26-6-2-5-25(34)23(26)17-33-12-3-4-21(16-33)30-29(35)20-7-9-24-22(15-20)28(32-31-24)19-8-10-27-18(14-19)11-13-37-27/h2,5-11,13-15,21,34H,3-4,12,16-17H2,1H3,(H,30,35)(H,31,32)/t21-/m1/s1 |
| InChIKey | KLSJQIARHYZYFN-OAQYLSRUSA-N |
| XLogP | 5.55 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|