About 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one (PubChem CID 56591428) has the molecular formula C19H19FN6O2
and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one.
Molecular Properties
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one |
| PubChem CID | 56591428 |
| Molecular Formula | C19H19FN6O2 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one |
| SMILES | CC1(O)CCC(n2c(=O)[nH]c3cnc(-c4cnc5ccc(F)cn45)nc32)CC1 |
| InChI | InChI=1S/C19H19FN6O2/c1-19(28)6-4-12(5-7-19)26-17-13(23-18(26)27)8-22-16(24-17)14-9-21-15-3-2-11(20)10-25(14)15/h2-3,8-10,12,28H,4-7H2,1H3,(H,23,27) |
| InChIKey | YNRDKRQTLMFUKL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one?
The IUPAC name of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one (CID 56591428) is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one.
What is the SMILES notation for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one?
The canonical SMILES for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one is CC1(O)CCC(n2c(=O)[nH]c3cnc(-c4cnc5ccc(F)cn45)nc32)CC1.
What is the InChIKey of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one?
The InChIKey is YNRDKRQTLMFUKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN6O2/c1-19(28)6-4-12(5-7-19)26-17-13(23-18(26)27)8-22-16(24-17)14-9-21-15-3-2-11(20)10-25(14)15/h2-3,8-10,12,28H,4-7H2,1H3,(H,23,27).
What are the key properties of 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one?
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one has a molecular weight of 382.40 g/mol, XLogP of 2.44, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-9-(4-hydroxy-4-methylcyclohexyl)-7H-purin-8-one is sourced from PubChem (CID 56591428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).