About (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate
(2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate (PubChem CID 56591492) has the molecular formula C17H11ClFNO9
and a molecular weight of 427.72 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate |
| PubChem CID | 56591492 |
| Molecular Formula | C17H11ClFNO9 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate |
| SMILES | CC(=O)OCOc1c(Cl)cc2cc(C(=O)ON3C(=O)CCC3=O)c(=O)oc2c1F |
| InChI | InChI=1S/C17H11ClFNO9/c1-7(21)26-6-27-15-10(18)5-8-4-9(16(24)28-14(8)13(15)19)17(25)29-20-11(22)2-3-12(20)23/h4-5H,2-3,6H2,1H3 |
| InChIKey | AIUOETZEWKOCIL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate (CID 56591492) is (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate is CC(=O)OCOc1c(Cl)cc2cc(C(=O)ON3C(=O)CCC3=O)c(=O)oc2c1F.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate?
The InChIKey is AIUOETZEWKOCIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClFNO9/c1-7(21)26-6-27-15-10(18)5-8-4-9(16(24)28-14(8)13(15)19)17(25)29-20-11(22)2-3-12(20)23/h4-5H,2-3,6H2,1H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate?
(2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate has a molecular weight of 427.72 g/mol, XLogP of 1.71, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 7-(acetyloxymethoxy)-6-chloro-8-fluoro-2-oxochromene-3-carboxylate is sourced from PubChem (CID 56591492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).