C32H40F7NO3S — CID 56591508
6-(3,4-difluorophenyl)-5-[6-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 56591508) has the molecular formula C32H40F7NO3S and a molecular weight of 651.73 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-5-[6-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(3,4-difluorophenyl)-5-[6-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 56591508 |
| Molecular Formula | C32H40F7NO3S |
| Molecular Weight | 651.73 g/mol |
| Exact Mass | 651.26 |
| IUPAC Name | 6-(3,4-difluorophenyl)-5-[6-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | CN(CCCCCCC1=C(c2ccc(F)c(F)c2)CCCc2cc(O)ccc21)CCCS(=O)(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H40F7NO3S/c1-40(18-8-20-44(42,43)19-7-16-31(35,36)32(37,38)39)17-5-3-2-4-10-28-26(24-12-15-29(33)30(34)22-24)11-6-9-23-21-25(41)13-14-27(23)28/h12-15,21-22,41H,2-11,16-20H2,1H3 |
| InChIKey | ZCRIYIOSTPVNEH-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.73 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|