C31H38F7NO3S — CID 56591510
6-(3,4-difluorophenyl)-5-[6-[methyl-[3-(3,3,4,4,4-pentafluorobutylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 56591510) has the molecular formula C31H38F7NO3S and a molecular weight of 637.70 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-5-[6-[methyl-[3-(3,3,4,4,4-pentafluorobutylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(3,4-difluorophenyl)-5-[6-[methyl-[3-(3,3,4,4,4-pentafluorobutylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 56591510 |
| Molecular Formula | C31H38F7NO3S |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 637.25 |
| IUPAC Name | 6-(3,4-difluorophenyl)-5-[6-[methyl-[3-(3,3,4,4,4-pentafluorobutylsulfonyl)propyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | CN(CCCCCCC1=C(c2ccc(F)c(F)c2)CCCc2cc(O)ccc21)CCCS(=O)(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H38F7NO3S/c1-39(17-7-18-43(41,42)19-15-30(34,35)31(36,37)38)16-5-3-2-4-9-27-25(23-11-14-28(32)29(33)21-23)10-6-8-22-20-24(40)12-13-26(22)27/h11-14,20-21,40H,2-10,15-19H2,1H3 |
| InChIKey | HDYMXHVVTOJFOH-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|