C33H42F7NO2S — CID 56591511
6-(3,4-difluorophenyl)-5-[6-[methyl-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol (PubChem CID 56591511) has the molecular formula C33H42F7NO2S and a molecular weight of 649.76 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-5-[6-[methyl-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol.
| Compound Name | 6-(3,4-difluorophenyl)-5-[6-[methyl-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
|---|---|
| PubChem CID | 56591511 |
| Molecular Formula | C33H42F7NO2S |
| Molecular Weight | 649.76 g/mol |
| Exact Mass | 649.28 |
| IUPAC Name | 6-(3,4-difluorophenyl)-5-[6-[methyl-[4-(4,4,5,5,5-pentafluoropentylsulfinyl)butyl]amino]hexyl]-8,9-dihydro-7H-benzo[7]annulen-2-ol |
| SMILES | CN(CCCCCCC1=C(c2ccc(F)c(F)c2)CCCc2cc(O)ccc21)CCCCS(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H42F7NO2S/c1-41(19-6-7-20-44(43)21-9-17-32(36,37)33(38,39)40)18-5-3-2-4-11-29-27(25-13-16-30(34)31(35)23-25)12-8-10-24-22-26(42)14-15-28(24)29/h13-16,22-23,42H,2-12,17-21H2,1H3 |
| InChIKey | ZVSPNNLWKWSBOL-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.76 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|