C15H18N2O5 — CID 56591678
ethyl N-[(3S,6S,7S,7aR)-6-hydroxy-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]carbamate (PubChem CID 56591678) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is ethyl N-[(3S,6S,7S,7aR)-6-hydroxy-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]carbamate.
| Compound Name | ethyl N-[(3S,6S,7S,7aR)-6-hydroxy-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]carbamate |
|---|---|
| PubChem CID | 56591678 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | ethyl N-[(3S,6S,7S,7aR)-6-hydroxy-5-oxo-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-7-yl]carbamate |
| SMILES | CCOC(=O)N[C@@H]1[C@H](O)C(=O)N2[C@H](c3ccccc3)OC[C@@H]12 |
| InChI | InChI=1S/C15H18N2O5/c1-2-21-15(20)16-11-10-8-22-14(9-6-4-3-5-7-9)17(10)13(19)12(11)18/h3-7,10-12,14,18H,2,8H2,1H3,(H,16,20)/t10-,11-,12-,14-/m0/s1 |
| InChIKey | GGHJFFRSJFEPJK-MNXVOIDGSA-N |
| XLogP | 0.40 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |