C18H16ClFN2O2 — CID 56591698
6-(3-chloro-4-fluorophenyl)-8-ethenyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylic acid (PubChem CID 56591698) has the molecular formula C18H16ClFN2O2 and a molecular weight of 346.79 g/mol. Its IUPAC name is 6-(3-chloro-4-fluorophenyl)-8-ethenyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylic acid.
| Compound Name | 6-(3-chloro-4-fluorophenyl)-8-ethenyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 56591698 |
| Molecular Formula | C18H16ClFN2O2 |
| Molecular Weight | 346.79 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 6-(3-chloro-4-fluorophenyl)-8-ethenyl-8-methyl-6,7-dihydro-5H-1,5-naphthyridine-2-carboxylic acid |
| SMILES | C=CC1(C)CC(c2ccc(F)c(Cl)c2)Nc2ccc(C(=O)O)nc21 |
| InChI | InChI=1S/C18H16ClFN2O2/c1-3-18(2)9-15(10-4-5-12(20)11(19)8-10)21-13-6-7-14(17(23)24)22-16(13)18/h3-8,15,21H,1,9H2,2H3,(H,23,24) |
| InChIKey | DIXHEMUZJZECJP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.79 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|