About 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine
1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine (PubChem CID 56592036) has the molecular formula C22H14FN5O
and a molecular weight of 383.39 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine.
Molecular Properties
| Compound Name | 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine |
| PubChem CID | 56592036 |
| Molecular Formula | C22H14FN5O |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine |
| SMILES | COc1nnc(-c2cc(-c3ccccc3F)nc3ncccc23)c2ccncc12 |
| InChI | InChI=1S/C22H14FN5O/c1-29-22-17-12-24-10-8-13(17)20(27-28-22)16-11-19(15-5-2-3-7-18(15)23)26-21-14(16)6-4-9-25-21/h2-12H,1H3 |
| InChIKey | HPAAMLQMBKFWAC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 73.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine?
The IUPAC name of 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine (CID 56592036) is 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine.
What is the SMILES notation for 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine?
The canonical SMILES for 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine is COc1nnc(-c2cc(-c3ccccc3F)nc3ncccc23)c2ccncc12.
What is the InChIKey of 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine?
The InChIKey is HPAAMLQMBKFWAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14FN5O/c1-29-22-17-12-24-10-8-13(17)20(27-28-22)16-11-19(15-5-2-3-7-18(15)23)26-21-14(16)6-4-9-25-21/h2-12H,1H3.
What are the key properties of 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine?
1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine has a molecular weight of 383.39 g/mol, XLogP of 4.45, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-4-methoxypyrido[3,4-d]pyridazine is sourced from PubChem (CID 56592036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).