About 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one
4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one (PubChem CID 56592122) has the molecular formula C22H13FN4O
and a molecular weight of 368.37 g/mol. Its IUPAC name is 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one.
Molecular Properties
| Compound Name | 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one |
| PubChem CID | 56592122 |
| Molecular Formula | C22H13FN4O |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one |
| SMILES | O=c1[nH]cc(-c2cc(-c3ccccc3F)nc3ncccc23)c2ccncc12 |
| InChI | InChI=1S/C22H13FN4O/c23-19-6-2-1-4-15(19)20-10-16(14-5-3-8-25-21(14)27-20)17-12-26-22(28)18-11-24-9-7-13(17)18/h1-12H,(H,26,28) |
| InChIKey | PXWCFDARLVIGRU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one?
The IUPAC name of 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one (CID 56592122) is 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one.
What is the SMILES notation for 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one?
The canonical SMILES for 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one is O=c1[nH]cc(-c2cc(-c3ccccc3F)nc3ncccc23)c2ccncc12.
What is the InChIKey of 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one?
The InChIKey is PXWCFDARLVIGRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13FN4O/c23-19-6-2-1-4-15(19)20-10-16(14-5-3-8-25-21(14)27-20)17-12-26-22(28)18-11-24-9-7-13(17)18/h1-12H,(H,26,28).
What are the key properties of 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one?
4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one has a molecular weight of 368.37 g/mol, XLogP of 4.34, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-fluorophenyl)-1,8-naphthyridin-4-yl]-2H-2,7-naphthyridin-1-one is sourced from PubChem (CID 56592122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).