C26H22F3NO9S — CID 56592139
(2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-5,6,8-trifluoro-2-oxochromen-3-yl]thiophen-2-yl]hexanoate (PubChem CID 56592139) has the molecular formula C26H22F3NO9S and a molecular weight of 581.52 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-5,6,8-trifluoro-2-oxochromen-3-yl]thiophen-2-yl]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-5,6,8-trifluoro-2-oxochromen-3-yl]thiophen-2-yl]hexanoate |
|---|---|
| PubChem CID | 56592139 |
| Molecular Formula | C26H22F3NO9S |
| Molecular Weight | 581.52 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[5-[7-(acetyloxymethoxy)-5,6,8-trifluoro-2-oxochromen-3-yl]thiophen-2-yl]hexanoate |
| SMILES | CC(=O)OCOc1c(F)c(F)c2cc(-c3ccc(CCCCCC(=O)ON4C(=O)CCC4=O)s3)c(=O)oc2c1F |
| InChI | InChI=1S/C26H22F3NO9S/c1-13(31)36-12-37-25-22(28)21(27)16-11-15(26(35)38-24(16)23(25)29)17-8-7-14(40-17)5-3-2-4-6-20(34)39-30-18(32)9-10-19(30)33/h7-8,11H,2-6,9-10,12H2,1H3 |
| InChIKey | XYBWUVUNGXKIEW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|