C34H45F4NO5S — CID 56592597
methyl 2-[6-[6-(4-fluorophenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]hexyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]acetate (PubChem CID 56592597) has the molecular formula C34H45F4NO5S and a molecular weight of 655.80 g/mol. Its IUPAC name is methyl 2-[6-[6-(4-fluorophenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]hexyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]acetate.
| Compound Name | methyl 2-[6-[6-(4-fluorophenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]hexyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]acetate |
|---|---|
| PubChem CID | 56592597 |
| Molecular Formula | C34H45F4NO5S |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | methyl 2-[6-[6-(4-fluorophenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]hexyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]acetate |
| SMILES | COC(=O)CN(CCCCCCC1=C(c2ccc(F)cc2)CCCc2cc(O)ccc21)CCCCS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C34H45F4NO5S/c1-44-33(41)25-39(21-6-7-22-45(42,43)23-9-19-34(36,37)38)20-5-3-2-4-11-32-30(26-13-15-28(35)16-14-26)12-8-10-27-24-29(40)17-18-31(27)32/h13-18,24,40H,2-12,19-23,25H2,1H3 |
| InChIKey | LEYIMOFWASIKSU-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|