C36H49F4NO5S — CID 56592759
methyl 4-[6-[6-(4-fluorophenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]hexyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]butanoate (PubChem CID 56592759) has the molecular formula C36H49F4NO5S and a molecular weight of 683.85 g/mol. Its IUPAC name is methyl 4-[6-[6-(4-fluorophenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]hexyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]butanoate.
| Compound Name | methyl 4-[6-[6-(4-fluorophenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]hexyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]butanoate |
|---|---|
| PubChem CID | 56592759 |
| Molecular Formula | C36H49F4NO5S |
| Molecular Weight | 683.85 g/mol |
| Exact Mass | 683.33 |
| IUPAC Name | methyl 4-[6-[6-(4-fluorophenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]hexyl-[4-(4,4,4-trifluorobutylsulfonyl)butyl]amino]butanoate |
| SMILES | COC(=O)CCCN(CCCCCCC1=C(c2ccc(F)cc2)CCCc2cc(O)ccc21)CCCCS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C36H49F4NO5S/c1-46-35(43)14-9-24-41(23-6-7-25-47(44,45)26-10-21-36(38,39)40)22-5-3-2-4-12-34-32(28-15-17-30(37)18-16-28)13-8-11-29-27-31(42)19-20-33(29)34/h15-20,27,42H,2-14,21-26H2,1H3 |
| InChIKey | IWMBHYNYVZQKPH-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.85 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|