About (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate
(2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate (PubChem CID 56592827) has the molecular formula C19H15ClFNO8
and a molecular weight of 439.78 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate |
| PubChem CID | 56592827 |
| Molecular Formula | C19H15ClFNO8 |
| Molecular Weight | 439.78 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate |
| SMILES | CC(C)(C)C(=O)Oc1c(Cl)cc2cc(C(=O)ON3C(=O)CCC3=O)c(=O)oc2c1F |
| InChI | InChI=1S/C19H15ClFNO8/c1-19(2,3)18(27)29-15-10(20)7-8-6-9(16(25)28-14(8)13(15)21)17(26)30-22-11(23)4-5-12(22)24/h6-7H,4-5H2,1-3H3 |
| InChIKey | NNNCIOUBLSAJBF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 120.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate (CID 56592827) is (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate is CC(C)(C)C(=O)Oc1c(Cl)cc2cc(C(=O)ON3C(=O)CCC3=O)c(=O)oc2c1F.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate?
The InChIKey is NNNCIOUBLSAJBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15ClFNO8/c1-19(2,3)18(27)29-15-10(20)7-8-6-9(16(25)28-14(8)13(15)21)17(26)30-22-11(23)4-5-12(22)24/h6-7H,4-5H2,1-3H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate?
(2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate has a molecular weight of 439.78 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 6-chloro-7-(2,2-dimethylpropanoyloxy)-8-fluoro-2-oxochromene-3-carboxylate is sourced from PubChem (CID 56592827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).