C15H19N3O2S — CID 56592932
1-cyclopentyl-3-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)urea (PubChem CID 56592932) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 1-cyclopentyl-3-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-cyclopentyl-3-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 56592932 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 1-cyclopentyl-3-(4-methoxy-7-methyl-1,3-benzothiazol-2-yl)urea |
| SMILES | COc1ccc(C)c2sc(NC(=O)NC3CCCC3)nc12 |
| InChI | InChI=1S/C15H19N3O2S/c1-9-7-8-11(20-2)12-13(9)21-15(17-12)18-14(19)16-10-5-3-4-6-10/h7-8,10H,3-6H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | VMKACTCQIHEMKP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |