C13H16F3N3O — CID 56593014
1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propan-1-one (PubChem CID 56593014) has the molecular formula C13H16F3N3O and a molecular weight of 287.28 g/mol. Its IUPAC name is 1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propan-1-one.
| Compound Name | 1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 56593014 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]propan-1-one |
| SMILES | CCC(=O)C1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C13H16F3N3O/c1-2-10(20)9-4-7-19(8-5-9)12-17-6-3-11(18-12)13(14,15)16/h3,6,9H,2,4-5,7-8H2,1H3 |
| InChIKey | WXTNFKKICDHQHQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |