C16H17Cl2N5S — CID 56593198
3-(azepan-1-ylmethyl)-6-(2,5-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 56593198) has the molecular formula C16H17Cl2N5S and a molecular weight of 382.32 g/mol. Its IUPAC name is 3-(azepan-1-ylmethyl)-6-(2,5-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(azepan-1-ylmethyl)-6-(2,5-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 56593198 |
| Molecular Formula | C16H17Cl2N5S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 3-(azepan-1-ylmethyl)-6-(2,5-dichlorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Clc1ccc(Cl)c(-c2nn3c(CN4CCCCCC4)nnc3s2)c1 |
| InChI | InChI=1S/C16H17Cl2N5S/c17-11-5-6-13(18)12(9-11)15-21-23-14(19-20-16(23)24-15)10-22-7-3-1-2-4-8-22/h5-6,9H,1-4,7-8,10H2 |
| InChIKey | IFHCFLCEXVUUBT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |