C9H15N3O — CID 56593241
1-(2-amino-3-methylbutanoyl)azetidine-2-carbonitrile (PubChem CID 56593241) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-(2-amino-3-methylbutanoyl)azetidine-2-carbonitrile.
| Compound Name | 1-(2-amino-3-methylbutanoyl)azetidine-2-carbonitrile |
|---|---|
| PubChem CID | 56593241 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 1-(2-amino-3-methylbutanoyl)azetidine-2-carbonitrile |
| SMILES | CC(C)C(N)C(=O)N1CCC1C#N |
| InChI | InChI=1S/C9H15N3O/c1-6(2)8(11)9(13)12-4-3-7(12)5-10/h6-8H,3-4,11H2,1-2H3 |
| InChIKey | UHKUQSBZFWWHQL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |