C18H22N4O2S — CID 56593646
N',4-diethyl-N-naphthalen-1-ylsulfonyl-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 56593646) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N',4-diethyl-N-naphthalen-1-ylsulfonyl-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | N',4-diethyl-N-naphthalen-1-ylsulfonyl-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 56593646 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N',4-diethyl-N-naphthalen-1-ylsulfonyl-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | CC/N=C(/NS(=O)(=O)c1cccc2ccccc12)N1CC(CC)C=N1 |
| InChI | InChI=1S/C18H22N4O2S/c1-3-14-12-20-22(13-14)18(19-4-2)21-25(23,24)17-11-7-9-15-8-5-6-10-16(15)17/h5-12,14H,3-4,13H2,1-2H3,(H,19,21) |
| InChIKey | UTCBGRDLKHYAOT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|