C20H25N7O2 — CID 56593684
3-N-[4-(3-morpholin-4-ylpropoxy)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine (PubChem CID 56593684) has the molecular formula C20H25N7O2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 3-N-[4-(3-morpholin-4-ylpropoxy)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[4-(3-morpholin-4-ylpropoxy)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 56593684 |
| Molecular Formula | C20H25N7O2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 3-N-[4-(3-morpholin-4-ylpropoxy)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2ccc(OCCCN3CCOCC3)cc2)nn1-c1ccccn1 |
| InChI | InChI=1S/C20H25N7O2/c21-19-24-20(25-27(19)18-4-1-2-9-22-18)23-16-5-7-17(8-6-16)29-13-3-10-26-11-14-28-15-12-26/h1-2,4-9H,3,10-15H2,(H3,21,23,24,25) |
| InChIKey | NIPJQRGYPGKSQY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|